Lafutidine

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443919033 | IUPAC_name = 2-[(2-furylmethyl)sulfinyl]-N-((2Z)-4-{[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxy}but-2-en-1-yl)acetamide | image = Lafutidine.png | width = 250

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oral

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ^Y | CAS_number = 118288-08-7 | ATC_prefix = A02 | ATC_suffix = BA08 | ATC_supplemental = | PubChem = 5282136 | DrugBank_Ref =  ^Y | DrugBank = | UNII_Ref =  ^Y | UNII = 49S4O7ADLC | KEGG_Ref =  ^Y | KEGG = D01131 | ChemSpiderID_Ref =  ^N | ChemSpiderID = 4445337

| chemical_formula = | C=22 | H=29 | N=3 | O=4 | S=1 | molecular_weight = 431.54 g/mol | smiles = C1CCN(CC1)CC2=CC(=NC=C2)OC/C=C\CNC(=O)C[S+](CC3=CC=CO3)[O-] | InChI = 1/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- | InChIKey = KMZQAVXSMUKBPD-DJWKRKHSBS | StdInChI_Ref =  ^N | StdInChI = 1S/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- | StdInChIKey_Ref =  ^N | StdInChIKey = KMZQAVXSMUKBPD-DJWKRKHSSA-N }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Lafutidine (INN) is a second generation histamine H₂ receptor antagonist having multimodal mechanism of action and used to treat gastrointestinal disorders. It is marketed in Japan and India.

Lafutidine is used to treat gastric ulcers, duodenal ulcers, stomal ulcers, wounds in the lining of the stomach associated with acute gastritis and with acute exacerbation of chronic gastritis.^[1][2]

Adverse events observed during clinical trials included constipation, diarrhea, drug rash, nausea or vomiting and dizziness.^[2]

Like other H2 receptor antagonists it prevents the secretion of gastric acid.^[2] It also activates calcitonin gene related peptide, resulting in the stimulation of nitric oxide (NO) and regulation of gastric mucosal blood flow, increases somatostatin levels also resulting in less gastric acid secretion, causes the stomach lining to generate more mucin, inhibits neutrophil activation thus preventing injury from inflammation, and blocks the attachment of H. pylori to gastric cells.^[2]

It is marketed in Japan as Stogar by UCB^[1] and in India as Lafaxid by Zuventus Healthcare.^[2]

Template:H2-receptor antagonist