Health Dictionary AI Health Chat Find an Online Doctor

Niflumic acid

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 457481224 | IUPAC_name = 2-{[3-(trifluoromethyl)phenyl]amino}nicotinic acid | image = Niflumic acid.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 2.5 hr[1] | excretion =

| CASNo_Ref =  ☒N | CAS_number_Ref =  ☑Y | CAS_number = 4394-00-7 | ATC_prefix = M01 | ATC_suffix = AX02 | ATC_supplemental = M02AA17 (WHO) | IUPHAR_ligand = 2439 | DrugBank_Ref =  ☑Y | DrugBank = | ChEMBL_Ref =  ☒N | ChEMBL = 63323 | UNII_Ref =  ☒N | UNII = 4U5MP5IUD8 | KEGG_Ref =  ☑Y | KEGG = D08275 | PubChem = 4488 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 4333 | smiles = C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F | InChI = 1/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20) | InChIKey = JZFPYUNJRRFVQU-UHFFFAOYAR | StdInChI_Ref =  ☒N | StdInChI = 1S/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20) | StdInChIKey_Ref =  ☒N | StdInChIKey = JZFPYUNJRRFVQU-UHFFFAOYSA-N

| C=13 | H=9 | F=3 | N=2 | O=2 | molecular_weight = 282.21797 g/mol }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Niflumic acid is a drug used for joint and muscular pain. It is categorized as an inhibitor of cyclooxygenase-2. In experimental biology, it has been employed to inhibit chloride channels.[2] It has also been reported to act on GABA-A[3] and NMDA channels[4] and to block T-type calcium channels.[5]

References

  1. “Half life”. Drug Bank. Retrieved 15 July 2011.
  2. Knauf, Philip A.; Mann, Nancy A (1984). “Use of niflumic acid to determine the nature of the asymmetry of the human erythrocyte anion exchange system”. J. Gen. Physiol. 83: 703–725. doi:10.1085/jgp.83.5.703. PMC 2215658. PMID 6736917.
  3. Sinkkonen ST et al. (2003): Receptor subtype-dependent positive and negative modulation of GABA(A) receptor function by niflumic acid, a nonsteroidal anti-inflammatory drug, Mol Pharmacol, p. 753-63. PMID 12920213
  4. Lerma J., Martin d.R. (1992). “Chloride transport blockers prevent N-methyl-D-aspartate receptor-channel complex activation”. Mol. Pharmacol. 41 (2): 217–222. PMID 1371581.
  5. Balderas E et al. (2012): Niflumic acid blocks native and recombinant T-type channels, J Cell Physiol, p. 2542-55. PMID 21898399

Template:Topical products for joint and muscular pain

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH