Otamixaban

{{Drugbox | Verifiedfields = changed | verifiedrevid = 462266309 | IUPAC_name = Methyl (2R,3R)-2-{3-[amino(imino)methyl]benzyl}-3-{[4-(1-oxidopyridin-4-yl)benzoyl]amino}butanoate | image = Otamixaban.png | image2 = Otamixaban 3D.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ^N | CAS_number = 193153-04-7 | ATC_prefix = none | ATC_suffix = | PubChem = 5496659 | DrugBank_Ref =  ^Y | DrugBank = | ChemSpiderID_Ref =  ^Y | ChemSpiderID = 4593439 | UNII_Ref =  ^Y | UNII = S173RED00L | ChEMBL_Ref =  ^Y | ChEMBL = 46618

| C=25 | H=26 | N=4 | O=4 | molecular_weight = 446.498 g/mol | smiles = O=C(OC)[C@H](Cc1cc(C(=[N@H])N)ccc1)[C@H](NC(=O)c3ccc(c2cc[n+]([O-])cc2)cc3)C | InChI = 1/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/t16-,22-/m1/s1 | InChIKey = PFGVNLZDWRZPJW-OPAMFIHVBD | StdInChI_Ref =  ^Y | StdInChI = 1S/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/t16-,22-/m1/s1 | StdInChIKey_Ref =  ^Y | StdInChIKey = PFGVNLZDWRZPJW-OPAMFIHVSA-N }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Otamixaban (INN) is an experimental injectable anticoagulant direct factor Xa inhibitor,^[1] that was investigated for the treatment for acute coronary syndrome. In 2013, Sanofi announced that it had ended development of the drug candidate after poor performance in a Phase III clinical trial.^[2][3]