Prednimustine

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 434002897 | IUPAC_name = (11β)-11,17-dihydroxy-3,20-dioxopregna-1,4-dien-21-yl 4-{4-[bis(2-chloroethyl)amino]phenyl}butanoate | image = Prednimustine.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ^Y | CAS_number = 29069-24-7 | ATC_prefix = L01 | ATC_suffix = AA08 | PubChem = 34457 | DrugBank_Ref =  ^Y | DrugBank = | UNII_Ref =  ^N | UNII = 9403SIO2S8 | KEGG_Ref =  ^Y | KEGG = C19512 | ChemSpiderID_Ref =  ^N | ChemSpiderID = 31708

| C=35 | H=45 | Cl=2 | N=1 | O=6 | molecular_weight = 646.64 g/mol | synonyms = [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-Dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate | smiles = C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)COC(=O)CCCc4ccc(cc4)N(CCCl)CCCl)O)CCC5=CC(=O)C=C[C@]35C)O | InChI = 1/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1 | InChIKey = HFVNWDWLWUCIHC-GUPDPFMOBT | StdInChI_Ref =  ^N | StdInChI = 1S/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1 | StdInChIKey_Ref =  ^N | StdInChIKey = HFVNWDWLWUCIHC-GUPDPFMOSA-N }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Prednimustine is a drug used in chemotherapy. It is the ester formed from two other drugs, prednisolone and chlorambucil.

It can be associated with myoclonus.^[1]