Health Dictionary
Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.
Fenticonazole
Introduction
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 447916794 | IUPAC_name = 1-[2-(2,4-dichlorophenyl)-2-{[4-(phenylsulfanyl)phenyl]methoxy}ethyl]-1H-imidazole | image =Fenticonazole.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = prescription | routes_of_administration = ovule, spray, cream
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref =  
| CAS_number = 72479-26-6
| ATC_prefix = D01
| ATC_suffix = AC12
| ATC_supplemental = G01AF12 (WHO)
| PubChem = 51755
| DrugBank_Ref = Â
| DrugBank =
| UNII_Ref = Â
| UNII = QG05NRB077
| KEGG_Ref = Â
| KEGG = D02582
| ChEBI_Ref =  
| ChEBI = 82863
| ChemSpiderID_Ref = Â
| ChemSpiderID = 46840
| C=24 | H=20 | Cl=2 | N=2 | O=1 | S=1
| molecular_weight = 455.4 g/mol
| smiles = c1ccc(cc1)Sc2ccc(cc2)COC(Cn3ccnc3)c4ccc(cc4Cl)Cl
| InChI = 1/C24H20Cl2N2OS/c25-19-8-11-22(23(26)14-19)24(15-28-13-12-27-17-28)29-16-18-6-9-21(10-7-18)30-20-4-2-1-3-5-20/h1-14,17,24H,15-16H2
| InChIKey = ZCJYUTQZBAIHBS-UHFFFAOYAE
| StdInChI_Ref = Â
| StdInChI = 1S/C24H20Cl2N2OS/c25-19-8-11-22(23(26)14-19)24(15-28-13-12-27-17-28)29-16-18-6-9-21(10-7-18)30-20-4-2-1-3-5-20/h1-14,17,24H,15-16H2
| StdInChIKey_Ref = Â
| StdInChIKey = ZCJYUTQZBAIHBS-UHFFFAOYSA-N
}}
Overview
Overview
Fenticonazole is an azole antifungal drug, used locally as the nitrate in the treatment of vulvovaginal candidiasis. It is active against a range of organisms including dermatophyte pathogens, Malassezia furfur, and Candida albicans.
Uses and administration
Uses and administration
A 200-mg pessary is inserted into the vagina at bedtime for 3 nights or a 600-mg pessary is inserted once only at bedtime. Fenticonazole nitrate is also applied topically as a 2% cream or solution for the treatment of fungal skin infections.
Adverse effects
Adverse effects
Burning and itching have been reported after the application of fenticonazole nitrate.
Intravaginal preparations of fenticonazole may damage latex contraceptives and additional contraceptive measures are therefore necessary during local administration.
References
References
- The Merck Index, 12th Edition. 4047
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]