Health Dictionary
Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.
Flufenamic acid
Introduction
{{Drugbox | Watchedfields = changed | verifiedrevid = 443821617 | IUPAC_name = 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid | image = flufenamic acid.png | image2 = Flufenamic acid0.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = S4 | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral, topical
| bioavailability = | protein_bound = extensively | metabolism = Hydroxylation, glucuronidation | elimination_half-life = ~3 h | excretion = 50% urine, 36% feces
| CASNo_Ref =  
| CAS_number_Ref = Â
| CAS_number = 530-78-9
| ATC_prefix = M01
| ATC_suffix = AG03
| PubChem = 3371
| IUPHAR_ligand = 2447
| DrugBank_Ref = Â
| DrugBank = DB02266
| ChemSpiderID_Ref = Â
| ChemSpiderID = 3254
| UNII_Ref = Â
| UNII = 60GCX7Y6BH
| KEGG_Ref = Â
| KEGG = D01581
| ChEBI_Ref = Â
| ChEBI = 42638
| ChEMBL_Ref = Â
| ChEMBL = 23588
| C=14 | H=10 | F=3 | N=1 | O=2
| molecular_weight = 281.22991 g/mol
| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)O
| InChI = 1/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| InChIKey = LPEPZBJOKDYZAD-UHFFFAOYAI
| StdInChI_Ref = Â
| StdInChI = 1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| StdInChIKey_Ref = Â
| StdInChIKey = LPEPZBJOKDYZAD-UHFFFAOYSA-N
| melting_point = 124
| melting_high = 125
| melting_notes = resolidification and remelting at 134°C to 136°C
| solubility = Practically insoluble in water; soluble in ethanol, chloroform and diethyl ether
}}
Overview
Overview
Flufenamic acid, also known as Fluffy or Fluf, is a non-steroidal anti-inflammatory drug.It is pale yellow crystalline powder. In humans, flufenamic acid acts in part by binding to and reducing the activity of prostaglandin F synthase and activating TRPC6, a property it shares with the anti-inflammatory herb St Johns Wort.
Flufenamic acid also blocks voltage-gated sodium channels responsible for the depolarising after-potential (DAP) that underlies phasic firing in the phasic firing of magnocellular neurons in the supraoptic and paraventricular nuclei.
References
References
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]