Health Dictionary Find a Doctor

Flufenamic acid

{{Drugbox | Watchedfields = changed | verifiedrevid = 443821617 | IUPAC_name = 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid | image = flufenamic acid.png | image2 = Flufenamic acid0.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = S4 | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral, topical

| bioavailability = | protein_bound = extensively | metabolism = Hydroxylation, glucuronidation | elimination_half-life = ~3 h | excretion = 50% urine, 36% feces

| CASNo_Ref =  ☑Y | CAS_number_Ref =  ☑Y | CAS_number = 530-78-9 | ATC_prefix = M01 | ATC_suffix = AG03 | PubChem = 3371 | IUPHAR_ligand = 2447 | DrugBank_Ref =  ☑Y | DrugBank = DB02266 | ChemSpiderID_Ref =  ☑Y | ChemSpiderID = 3254 | UNII_Ref =  ☑Y | UNII = 60GCX7Y6BH | KEGG_Ref =  ☑Y | KEGG = D01581 | ChEBI_Ref =  ☑Y | ChEBI = 42638 | ChEMBL_Ref =  ☑Y | ChEMBL = 23588

| C=14 | H=10 | F=3 | N=1 | O=2 | molecular_weight = 281.22991 g/mol | smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)O | InChI = 1/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) | InChIKey = LPEPZBJOKDYZAD-UHFFFAOYAI | StdInChI_Ref =  ☑Y | StdInChI = 1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) | StdInChIKey_Ref =  ☑Y | StdInChIKey = LPEPZBJOKDYZAD-UHFFFAOYSA-N | melting_point = 124 | melting_high = 125 | melting_notes = resolidification and remelting at 134°C to 136°C | solubility = Practically insoluble in water; soluble in ethanol, chloroform and diethyl ether }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Flufenamic acid, also known as Fluffy or Fluf, is a non-steroidal anti-inflammatory drug.It is pale yellow crystalline powder. In humans, flufenamic acid acts in part by binding to and reducing the activity of prostaglandin F synthase and activating TRPC6, a property it shares with the anti-inflammatory herb St Johns Wort.

Flufenamic acid also blocks voltage-gated sodium channels responsible for the depolarising after-potential (DAP) that underlies phasic firing in the phasic firing of magnocellular neurons in the supraoptic and paraventricular nuclei.

References

References

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH