Health Dictionary Find a Doctor

Ioglicic acid

{{Drugbox | IUPAC_name = 3-acetamido-2,4,6-triiodo-5-{[(methylcarbamoyl)methyl]carbamoyl}benzoic acid | image =Ioglicic acid.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 49755-67-1 | ATC_prefix = V08 | ATC_suffix = AA06 | PubChem = 65437 | DrugBank = | ChemSpiderID = 58900 | UNII_Ref =  ☑Y | UNII = 3LGR5S8101 | KEGG = D04574 | ChEMBL = 1201291

| C=13 | H=12 | I=3 | N=3 | O=5 | molecular_weight = 670.96 g/mol | smiles = Ic1c(c(I)c(c(I)c1NC(=O)C)C(=O)O)C(=O)NCC(=O)NC }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Ioglicic acid is a molecule used as a contrast medium.

References

References


Template:Contrast media

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH