Health Dictionary Find a Doctor

Ioglycamic acid

{{Drugbox | IUPAC_name = 3-(2-{[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]methoxy}acetamido)-2,4,6-triiodobenzoic acid | image =Ioglycamic acid.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 2618-25-9 | ATC_prefix = V08 | ATC_suffix = AC03 | PubChem = 17477 | DrugBank = | ChemSpiderID = 16526 | ChEMBL = 2106372 | UNII_Ref =  ☑Y | UNII = ET36GPP4T7

| C=18 | H=10 | I=6 | N=2 | O=7 | molecular_weight = 1127.71 g/mol | smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)COCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Ioglycamic acid is a molecule used as a contrast medium.

References

References

Template:Contrast media

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH