Health Dictionary
Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.
Iotroxic acid
Introduction
{{Drugbox | IUPAC_name = 3-{2-[2-(2-{[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]methoxy}ethoxy)ethoxy]acetamido}-2,4,6-triiodobenzoic acid | image = Iotroxic acid wiki str.png
| tradename =
| Drugs.com = International Drug Names
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 51022-74-3
| ATC_prefix = V08
| ATC_suffix = AC02
| PubChem = 3740
| DrugBank =
| ChemSpiderID = 3609
| ChEMBL = 1651905
| UNII_Ref =  
| UNII = 84C5PTP9X6
| KEGG = D01388
| C=22 | H=18 | I=6 | N=2 | O=9 | molecular_weight = 1215.81314 g/mol | smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)COCCOCCOCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I }}
Overview
Overview
Iotroxic acid (INN), also known as meglumine iotroxate (BAN),[1] is a molecule used as a contrast medium.
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]