Health Dictionary Find a Doctor

Ioxaglic acid

{{Drugbox | IUPAC_name = 3-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodo-5-(2-{[2,4,6-triiodo-3-(methylcarbamoyl)-5-(N-methylacetamido)phenyl]formamido}acetamido)benzoic acid | image = Ioxaglic acid wiki str.png


| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = | ATC_prefix = V08 | ATC_suffix = AB03 | PubChem = 3742 | DrugBank = | UNII_Ref =  ☑Y | UNII = Z40X7EI2AF | KEGG = D01761 | ChEMBL = 1201291 | ChemSpiderID = 3611

| chemical_formula = | C=24 | H=21 | I=6 | N=5 | O=8 | molecular_weight = 1268.87906 g/mol | smiles = CC(=O)N(C)C1=C(C(=C(C(=C1I)C(=O)NCC(=O)NC2=C(C(=C(C(=C2I)C(=O)O)I)C(=O)NCCO)I)I)C(=O)NC)I | InChI = 1/C24H21I6N5O8/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43) | InChIKey = TYYBFXNZMFNZJT-UHFFFAOYAE | StdInChI = 1S/C24H21I6N5O8/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43) | StdInChIKey = TYYBFXNZMFNZJT-UHFFFAOYSA-N

}}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Ioxaglic acid (trade name Hexabrix) is an iodine containing molecule used as a low-osmolality contrast medium.[1]

References

References

  1. PMID 6999377 (PMID 6999377)
    Citation will be completed automatically in a few minutes. Jump the queue or expand by hand

Template:Contrast media


Template:Pharmacology-stub

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH