Health Dictionary AI Health Chat Find an Online Doctor

Lafutidine

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443919033 | IUPAC_name = 2-[(2-furylmethyl)sulfinyl]-N-((2Z)-4-{[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxy}but-2-en-1-yl)acetamide | image = Lafutidine.png | width = 250

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oral

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ☑Y | CAS_number = 118288-08-7 | ATC_prefix = A02 | ATC_suffix = BA08 | ATC_supplemental = | PubChem = 5282136 | DrugBank_Ref =  ☑Y | DrugBank = | UNII_Ref =  ☑Y | UNII = 49S4O7ADLC | KEGG_Ref =  ☑Y | KEGG = D01131 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 4445337

| chemical_formula = | C=22 | H=29 | N=3 | O=4 | S=1 | molecular_weight = 431.54 g/mol | smiles = C1CCN(CC1)CC2=CC(=NC=C2)OC/C=C\CNC(=O)C[S+](CC3=CC=CO3)[O-] | InChI = 1/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- | InChIKey = KMZQAVXSMUKBPD-DJWKRKHSBS | StdInChI_Ref =  ☒N | StdInChI = 1S/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- | StdInChIKey_Ref =  ☒N | StdInChIKey = KMZQAVXSMUKBPD-DJWKRKHSSA-N }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Lafutidine (INN) is a second generation histamine H2 receptor antagonist having multimodal mechanism of action and used to treat gastrointestinal disorders. It is marketed in Japan and India.

Medical use

Medical use

Lafutidine is used to treat gastric ulcers, duodenal ulcers, stomal ulcers, wounds in the lining of the stomach associated with acute gastritis and with acute exacerbation of chronic gastritis.[1][2]

Adverse effects

Adverse effects

Adverse events observed during clinical trials included constipation, diarrhea, drug rash, nausea or vomiting and dizziness.[2]

Mechanisms of action

Mechanisms of action

Like other H2 receptor antagonists it prevents the secretion of gastric acid.[2] It also activates calcitonin gene related peptide, resulting in the stimulation of nitric oxide (NO) and regulation of gastric mucosal blood flow, increases somatostatin levels also resulting in less gastric acid secretion, causes the stomach lining to generate more mucin, inhibits neutrophil activation thus preventing injury from inflammation, and blocks the attachment of H. pylori to gastric cells.[2]

History

History

It is marketed in Japan as Stogar by UCB[1] and in India as Lafaxid by Zuventus Healthcare.[2]

References

References

  1. 1.0 1.1 UCB Japan Revised: April 2005 Stogar tablets
  2. 2.0 2.1 2.2 2.3 2.4 Zuventus Healthcare Ltd. India Lafaxid tablets

Template:H2-receptor antagonist

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH