Developer site: The content shown here is test data.

MyEClinic
MyEClinic
Health Dictionary AI Health Chat Find an Online Doctor
A serene Zen garden with raked sand and smooth stones, symbolising clarity and calm

Health Dictionary

Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.

Back to skin conditions

Niflumic acid

Introduction

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 457481224 | IUPAC_name = 2-{[3-(trifluoromethyl)phenyl]amino}nicotinic acid | image = Niflumic acid.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 2.5 hr[1] | excretion =

| CASNo_Ref =  ☒N | CAS_number_Ref =  ☑Y | CAS_number = 4394-00-7 | ATC_prefix = M01 | ATC_suffix = AX02 | ATC_supplemental = M02AA17 (WHO) | IUPHAR_ligand = 2439 | DrugBank_Ref =  ☑Y | DrugBank = | ChEMBL_Ref =  ☒N | ChEMBL = 63323 | UNII_Ref =  ☒N | UNII = 4U5MP5IUD8 | KEGG_Ref =  ☑Y | KEGG = D08275 | PubChem = 4488 | ChemSpiderID_Ref =  ☒N | ChemSpiderID = 4333 | smiles = C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F | InChI = 1/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20) | InChIKey = JZFPYUNJRRFVQU-UHFFFAOYAR | StdInChI_Ref =  ☒N | StdInChI = 1S/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20) | StdInChIKey_Ref =  ☒N | StdInChIKey = JZFPYUNJRRFVQU-UHFFFAOYSA-N

| C=13 | H=9 | F=3 | N=2 | O=2 | molecular_weight = 282.21797 g/mol }}

Overview

Overview

Niflumic acid is a drug used for joint and muscular pain. It is categorized as an inhibitor of cyclooxygenase-2. In experimental biology, it has been employed to inhibit chloride channels.[2] It has also been reported to act on GABA-A[3] and NMDA channels[4] and to block T-type calcium channels.[5]

References

References

  1. ↑ “Half life”. Drug Bank. Retrieved 15 July 2011.
  2. ↑ Knauf, Philip A.; Mann, Nancy A (1984). “Use of niflumic acid to determine the nature of the asymmetry of the human erythrocyte anion exchange system”. J. Gen. Physiol. 83: 703–725. doi:10.1085/jgp.83.5.703. PMC 2215658. PMID 6736917.
  3. ↑ Sinkkonen ST et al. (2003): Receptor subtype-dependent positive and negative modulation of GABA(A) receptor function by niflumic acid, a nonsteroidal anti-inflammatory drug, Mol Pharmacol, p. 753-63. PMID 12920213
  4. ↑ Lerma J., Martin d.R. (1992). “Chloride transport blockers prevent N-methyl-D-aspartate receptor-channel complex activation”. Mol. Pharmacol. 41 (2): 217–222. PMID 1371581.
  5. ↑ Balderas E et al. (2012): Niflumic acid blocks native and recombinant T-type channels, J Cell Physiol, p. 2542-55. PMID 21898399

Template:Topical products for joint and muscular pain

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]