Health Dictionary
Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.
Nylidrin
Introduction
{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 447-41-6
| ATC_prefix = C04
| ATC_suffix = AA02
| ATC_supplemental = G02CA02 (WHO)
| PubChem = 4567
| DrugBank =
| ChemSpiderID = 4407
| UNII_Ref =  
| UNII = 695DKH33EI
| ChEMBL_Ref = Â
| ChEMBL = 114655
| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 | InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE }}
Overview
Overview
Buphenine (or nylidrin) is a beta-adrenergic agonist[1] that acts as a vasodilator via beta-2 receptors.
References
References
- ↑ Mittag TW, Tormay A, Messenger M, Podos SM (February 1985). “Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin”. Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]