Health Dictionary Find a Doctor

Buphenine

{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 447-41-6 | ATC_prefix = C04 | ATC_suffix = AA02 | ATC_supplemental = G02CA02 (WHO) | PubChem = 4567 | DrugBank = | ChemSpiderID = 4407 | UNII_Ref =  ☑Y | UNII = 695DKH33EI | ChEMBL_Ref =  ☑Y | ChEMBL = 114655

| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 | InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE }}

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Buphenine (or nylidrin) is a beta-adrenergic agonist[1] that acts as a vasodilator via beta-2 receptors.

References

References

  1. Mittag TW, Tormay A, Messenger M, Podos SM (February 1985). “Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin”. Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.

Template:Peripheral vasodilators

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH