Health Dictionary
Reliable, easy-to-read patient information on common medical conditions — written in plain language, free of jargon, and grounded in current evidence. Browse the most frequent diagnoses, understand what they mean for everyday life, and learn which steps and questions help you have a focused conversation with your doctor.
Otamixaban
Introduction
{{Drugbox | Verifiedfields = changed | verifiedrevid = 462266309 | IUPAC_name = Methyl (2R,3R)-2-{3-[amino(imino)methyl]benzyl}-3-{[4-(1-oxidopyridin-4-yl)benzoyl]amino}butanoate | image = Otamixaban.png | image2 = Otamixaban 3D.png
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref =  
| CAS_number = 193153-04-7
| ATC_prefix = none
| ATC_suffix =
| PubChem = 5496659
| DrugBank_Ref =  
| DrugBank =
| ChemSpiderID_Ref = Â
| ChemSpiderID = 4593439
| UNII_Ref = Â
| UNII = S173RED00L
| ChEMBL_Ref = Â
| ChEMBL = 46618
| C=25 | H=26 | N=4 | O=4
| molecular_weight = 446.498 g/mol
| smiles = O=C(OC)[C@H](Cc1cc(C(=[N@H])N)ccc1)[C@H](NC(=O)c3ccc(c2cc[n+]([O-])cc2)cc3)C
| InChI = 1/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/t16-,22-/m1/s1
| InChIKey = PFGVNLZDWRZPJW-OPAMFIHVBD
| StdInChI_Ref = Â
| StdInChI = 1S/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/t16-,22-/m1/s1
| StdInChIKey_Ref = Â
| StdInChIKey = PFGVNLZDWRZPJW-OPAMFIHVSA-N
}}
Overview
Overview
Otamixaban (INN) is an experimental injectable anticoagulant direct factor Xa inhibitor,[1] that was investigated for the treatment for acute coronary syndrome. In 2013, Sanofi announced that it had ended development of the drug candidate after poor performance in a Phase III clinical trial.[2][3]
References
References
- ↑ Guertin KR, Choi YM (2007). “The discovery of the Factor Xa inhibitor otamixaban: from lead identification to clinical development”. Curr. Med. Chem. 14 (23): 2471–81. doi:10.2174/092986707782023659. PMID 17979700.
- ↑ “AstraZeneca, Sanofi Cut Programs”. Chemical & Engineering News. American Chemical Society. 91 (23): 17. June 10, 2013.
Sanofi is ending development on two compounds, the anticancer compound iniparib and the anticoagulant otamixaban, both of which flunked Phase III studies.
- ↑ “Sanofi’s Investigational Iniparib, Otamixaban Fail To Meet Goals, Ends Programs”. RTT news. Retrieved 11 April 2014.
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]