Health Dictionary AI Health Chat Find an Online Doctor

Terizidone

{{Drugbox | Verifiedfields = changed | verifiedrevid = 470602455 | IUPAC_name = 4,4′-{1,4-phenylenebis[(E)methylylidenenitrilo]}diisoxazolidin-3-one | image = Terizidone.png | image2 = Terizidone_ball-and-stick.png


| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = C | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ☒N | CAS_number = 25683-71-0 | ATC_prefix = J04 | ATC_suffix = AK03 | PubChem = 65720 | DrugBank_Ref =  ☑Y | DrugBank = | ChemSpiderID_Ref =  ☑Y | ChemSpiderID = 59144 | UNII_Ref =  ☑Y | UNII = 1199LEX5N8 | KEGG_Ref =  ☑Y | KEGG = D07247

| C=14 | H=14 | N=4 | O=4 | molecular_weight = 302.286 g/mol | smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2 | InChI = 1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | InChIKey = ODKYYBOHSVLGNU-IAGONARPBB | StdInChI_Ref =  ☑Y | StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | StdInChIKey_Ref =  ☑Y | StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N | synonyms = 4-[({4-[N-(3-oxo-1,2-oxazolidin-4-yl)carboximidoyl]phenyl}methylidene)amino]-1,2-oxazolidin-3-one }}


Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Overview

Terizidone is a drug used in the treatment of tuberculosis.

References

References


Template:WikiDoc Sources

Looking for the patient version?

Back to the patient-friendly article

© 2026 MyEClinic – IFTM Institut für Telematik in der Medizin GmbH